C25H40O5 — CID 88788130
trans-(2R,3S)-2-(6,8-dihydroxy-7-oxoocta-3,5-dienyl)-3-[3-hydroxy-3-(1-pentylcyclobutyl)propyl]cyclopentan-1-one (PubChem CID 88788130) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is trans-(2R,3S)-2-(6,8-dihydroxy-7-oxoocta-3,5-dienyl)-3-[3-hydroxy-3-(1-pentylcyclobutyl)propyl]cyclopentan-1-one.
| Compound Name | trans-(2R,3S)-2-(6,8-dihydroxy-7-oxoocta-3,5-dienyl)-3-[3-hydroxy-3-(1-pentylcyclobutyl)propyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 88788130 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | trans-(2R,3S)-2-(6,8-dihydroxy-7-oxoocta-3,5-dienyl)-3-[3-hydroxy-3-(1-pentylcyclobutyl)propyl]cyclopentan-1-one |
| SMILES | CCCCCC1(C(O)CC[C@H]2CCC(=O)[C@@H]2CCC=CC=C(O)C(=O)CO)CCC1 |
| InChI | InChI=1S/C25H40O5/c1-2-3-7-15-25(16-8-17-25)24(30)14-12-19-11-13-21(27)20(19)9-5-4-6-10-22(28)23(29)18-26/h4,6,10,19-20,24,26,28,30H,2-3,5,7-9,11-18H2,1H3/t19-,20-,24?/m1/s1 |
| InChIKey | BRXJQKKCEIHZKU-GNPFLCDCSA-N |
| XLogP | 4.81 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|