C22H34O4 — CID 54382044
7-[2-(3-hydroxy-4,4-dimethyloct-1-enyl)-5-oxocyclopentyl]hepta-2,4-dienoic acid (PubChem CID 54382044) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 7-[2-(3-hydroxy-4,4-dimethyloct-1-enyl)-5-oxocyclopentyl]hepta-2,4-dienoic acid.
| Compound Name | 7-[2-(3-hydroxy-4,4-dimethyloct-1-enyl)-5-oxocyclopentyl]hepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 54382044 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 7-[2-(3-hydroxy-4,4-dimethyloct-1-enyl)-5-oxocyclopentyl]hepta-2,4-dienoic acid |
| SMILES | CCCCC(C)(C)C(O)C=CC1CCC(=O)C1CCC=CC=CC(=O)O |
| InChI | InChI=1S/C22H34O4/c1-4-5-16-22(2,3)20(24)15-13-17-12-14-19(23)18(17)10-8-6-7-9-11-21(25)26/h6-7,9,11,13,15,17-18,20,24H,4-5,8,10,12,14,16H2,1-3H3,(H,25,26) |
| InChIKey | VAPGUVRFDOCKDM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|