C20H33FO2 — CID 70612571
trans-(2R,3R)-3-(4-fluoro-3-hydroxyoct-1-enyl)-2-[(E)-hept-3-enyl]cyclopentan-1-one (PubChem CID 70612571) has the molecular formula C20H33FO2 and a molecular weight of 324.48 g/mol. Its IUPAC name is trans-(2R,3R)-3-(4-fluoro-3-hydroxyoct-1-enyl)-2-[(E)-hept-3-enyl]cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-3-(4-fluoro-3-hydroxyoct-1-enyl)-2-[(E)-hept-3-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 70612571 |
| Molecular Formula | C20H33FO2 |
| Molecular Weight | 324.48 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | trans-(2R,3R)-3-(4-fluoro-3-hydroxyoct-1-enyl)-2-[(E)-hept-3-enyl]cyclopentan-1-one |
| SMILES | CCC/C=C/CC[C@H]1C(=O)CC[C@@H]1C=CC(O)C(F)CCCC |
| InChI | InChI=1S/C20H33FO2/c1-3-5-7-8-9-10-17-16(12-14-19(17)22)13-15-20(23)18(21)11-6-4-2/h7-8,13,15-18,20,23H,3-6,9-12,14H2,1-2H3/b8-7+,15-13?/t16-,17-,18?,20?/m1/s1 |
| InChIKey | HYKYBAPMAVHLPE-UQBQETNZSA-N |
| XLogP | 5.16 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|