C22H33FO5 — CID 54158140
7-[(1R,2R)-2-[(3R)-4-fluoro-3-hydroxydeca-1,4-dienyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid (PubChem CID 54158140) has the molecular formula C22H33FO5 and a molecular weight of 396.50 g/mol. Its IUPAC name is 7-[(1R,2R)-2-[(3R)-4-fluoro-3-hydroxydeca-1,4-dienyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-[(3R)-4-fluoro-3-hydroxydeca-1,4-dienyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid |
|---|---|
| PubChem CID | 54158140 |
| Molecular Formula | C22H33FO5 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 7-[(1R,2R)-2-[(3R)-4-fluoro-3-hydroxydeca-1,4-dienyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoic acid |
| SMILES | CCCCCC=C(F)[C@H](O)C=C[C@H]1CCC(=O)[C@@H]1CC=CCCC(O)C(=O)O |
| InChI | InChI=1S/C22H33FO5/c1-2-3-4-7-10-18(23)20(25)15-13-16-12-14-19(24)17(16)9-6-5-8-11-21(26)22(27)28/h5-6,10,13,15-17,20-21,25-26H,2-4,7-9,11-12,14H2,1H3,(H,27,28)/t16-,17-,20-,21?/m1/s1 |
| InChIKey | OMMYMEDKRIZDFD-RTXQYVBWSA-N |
| XLogP | 4.10 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|