C21H31F3O5 — CID 57209717
2-hydroxy-7-[(1R,2R)-2-[4-hydroxy-4-(trifluoromethyl)oct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 57209717) has the molecular formula C21H31F3O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-hydroxy-7-[(1R,2R)-2-[4-hydroxy-4-(trifluoromethyl)oct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 2-hydroxy-7-[(1R,2R)-2-[4-hydroxy-4-(trifluoromethyl)oct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57209717 |
| Molecular Formula | C21H31F3O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 2-hydroxy-7-[(1R,2R)-2-[4-hydroxy-4-(trifluoromethyl)oct-1-enyl]-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(O)(CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCC(O)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C21H31F3O5/c1-2-3-13-20(29,21(22,23)24)14-7-8-15-11-12-17(25)16(15)9-5-4-6-10-18(26)19(27)28/h4-5,7-8,15-16,18,26,29H,2-3,6,9-14H2,1H3,(H,27,28)/t15-,16+,18?,20?/m0/s1 |
| InChIKey | WYPBTVZIROOHFR-LBLBDHKGSA-N |
| XLogP | 4.18 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|