C25H40O5S — CID 56992885
7-[(1R,2R)-2-(4-cyclopropyl-4-hydroxyoct-1-enyl)-5-oxocyclopentyl]-2-(2-hydroxyethylsulfanyl)hept-5-enoic acid (PubChem CID 56992885) has the molecular formula C25H40O5S and a molecular weight of 452.66 g/mol. Its IUPAC name is 7-[(1R,2R)-2-(4-cyclopropyl-4-hydroxyoct-1-enyl)-5-oxocyclopentyl]-2-(2-hydroxyethylsulfanyl)hept-5-enoic acid.
| Compound Name | 7-[(1R,2R)-2-(4-cyclopropyl-4-hydroxyoct-1-enyl)-5-oxocyclopentyl]-2-(2-hydroxyethylsulfanyl)hept-5-enoic acid |
|---|---|
| PubChem CID | 56992885 |
| Molecular Formula | C25H40O5S |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | 7-[(1R,2R)-2-(4-cyclopropyl-4-hydroxyoct-1-enyl)-5-oxocyclopentyl]-2-(2-hydroxyethylsulfanyl)hept-5-enoic acid |
| SMILES | CCCCC(O)(CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCC(SCCO)C(=O)O)C1CC1 |
| InChI | InChI=1S/C25H40O5S/c1-2-3-15-25(30,20-12-13-20)16-7-8-19-11-14-22(27)21(19)9-5-4-6-10-23(24(28)29)31-18-17-26/h4-5,7-8,19-21,23,26,30H,2-3,6,9-18H2,1H3,(H,28,29)/t19-,21+,23?,25?/m0/s1 |
| InChIKey | SDRHRPOAUMCGAF-KSNRECHZSA-N |
| XLogP | 4.76 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|