C22H36O6S — CID 54418458
2-hydroxy-3-(2-hydroxyethylsulfanyl)-7-[(1R,2R)-2-(4-hydroxyoct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 54418458) has the molecular formula C22H36O6S and a molecular weight of 428.59 g/mol. Its IUPAC name is 2-hydroxy-3-(2-hydroxyethylsulfanyl)-7-[(1R,2R)-2-(4-hydroxyoct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 2-hydroxy-3-(2-hydroxyethylsulfanyl)-7-[(1R,2R)-2-(4-hydroxyoct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54418458 |
| Molecular Formula | C22H36O6S |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 2-hydroxy-3-(2-hydroxyethylsulfanyl)-7-[(1R,2R)-2-(4-hydroxyoct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(O)CC=C[C@H]1CCC(=O)[C@@H]1CC=CCC(SCCO)C(O)C(=O)O |
| InChI | InChI=1S/C22H36O6S/c1-2-3-8-17(24)9-6-7-16-12-13-19(25)18(16)10-4-5-11-20(29-15-14-23)21(26)22(27)28/h4-7,16-18,20-21,23-24,26H,2-3,8-15H2,1H3,(H,27,28)/t16-,17?,18+,20?,21?/m0/s1 |
| InChIKey | VZCNXNDPLPQDEX-WYEUGONTSA-N |
| XLogP | 2.96 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|