C24H40O6S — CID 57122532
(3S)-3-(2-hydroxyethylsulfanyl)-2-(hydroxymethyl)-7-[(1R,2R)-2-(8-methoxyoct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 57122532) has the molecular formula C24H40O6S and a molecular weight of 456.65 g/mol. Its IUPAC name is (3S)-3-(2-hydroxyethylsulfanyl)-2-(hydroxymethyl)-7-[(1R,2R)-2-(8-methoxyoct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (3S)-3-(2-hydroxyethylsulfanyl)-2-(hydroxymethyl)-7-[(1R,2R)-2-(8-methoxyoct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57122532 |
| Molecular Formula | C24H40O6S |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | (3S)-3-(2-hydroxyethylsulfanyl)-2-(hydroxymethyl)-7-[(1R,2R)-2-(8-methoxyoct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | COCCCCCCC=C[C@H]1CCC(=O)[C@@H]1CC=CC[C@H](SCCO)C(CO)C(=O)O |
| InChI | InChI=1S/C24H40O6S/c1-30-16-9-5-3-2-4-6-10-19-13-14-22(27)20(19)11-7-8-12-23(31-17-15-25)21(18-26)24(28)29/h6-8,10,19-21,23,25-26H,2-5,9,11-18H2,1H3,(H,28,29)/t19-,20+,21?,23-/m0/s1 |
| InChIKey | CMTOZKOTCCHXKM-FANLQWHUSA-N |
| XLogP | 3.86 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|