C23H38O4 — CID 57136006
trans-(2R,3R)-3-(4-ethenyl-4,9-dihydroxynon-1-enyl)-2-(7-hydroxyhept-2-enyl)cyclopentan-1-one (PubChem CID 57136006) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is trans-(2R,3R)-3-(4-ethenyl-4,9-dihydroxynon-1-enyl)-2-(7-hydroxyhept-2-enyl)cyclopentan-1-one.
| Compound Name | trans-(2R,3R)-3-(4-ethenyl-4,9-dihydroxynon-1-enyl)-2-(7-hydroxyhept-2-enyl)cyclopentan-1-one |
|---|---|
| PubChem CID | 57136006 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | trans-(2R,3R)-3-(4-ethenyl-4,9-dihydroxynon-1-enyl)-2-(7-hydroxyhept-2-enyl)cyclopentan-1-one |
| SMILES | C=CC(O)(CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCCCO)CCCCCO |
| InChI | InChI=1S/C23H38O4/c1-2-23(27,16-8-6-10-19-25)17-11-12-20-14-15-22(26)21(20)13-7-4-3-5-9-18-24/h2,4,7,11-12,20-21,24-25,27H,1,3,5-6,8-10,13-19H2/t20-,21+,23?/m0/s1 |
| InChIKey | FUXCWCDMKUDYJR-ZOAFEQKISA-N |
| XLogP | 4.11 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|