C24H36O6 — CID 54384739
2-acetyloxy-7-[(1R,2R)-2-(4-ethenyl-4-hydroxyoct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 54384739) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is 2-acetyloxy-7-[(1R,2R)-2-(4-ethenyl-4-hydroxyoct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | 2-acetyloxy-7-[(1R,2R)-2-(4-ethenyl-4-hydroxyoct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54384739 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 2-acetyloxy-7-[(1R,2R)-2-(4-ethenyl-4-hydroxyoct-1-enyl)-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | C=CC(O)(CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCC(OC(C)=O)C(=O)O)CCCC |
| InChI | InChI=1S/C24H36O6/c1-4-6-16-24(29,5-2)17-10-11-19-14-15-21(26)20(19)12-8-7-9-13-22(23(27)28)30-18(3)25/h5,7-8,10-11,19-20,22,29H,2,4,6,9,12-17H2,1,3H3,(H,27,28)/t19-,20+,22?,24?/m0/s1 |
| InChIKey | VCKPVCFRLPGHPS-MICDNJKTSA-N |
| XLogP | 4.38 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|