C25H40O5 — CID 54099508
methyl 7-[(1R,2R)-2-(4-ethenyl-4-hydroxydec-1-enyl)-5-oxocyclopentyl]-2-hydroxyhept-5-enoate (PubChem CID 54099508) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is methyl 7-[(1R,2R)-2-(4-ethenyl-4-hydroxydec-1-enyl)-5-oxocyclopentyl]-2-hydroxyhept-5-enoate.
| Compound Name | methyl 7-[(1R,2R)-2-(4-ethenyl-4-hydroxydec-1-enyl)-5-oxocyclopentyl]-2-hydroxyhept-5-enoate |
|---|---|
| PubChem CID | 54099508 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | methyl 7-[(1R,2R)-2-(4-ethenyl-4-hydroxydec-1-enyl)-5-oxocyclopentyl]-2-hydroxyhept-5-enoate |
| SMILES | C=CC(O)(CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCC(O)C(=O)OC)CCCCCC |
| InChI | InChI=1S/C25H40O5/c1-4-6-7-11-18-25(29,5-2)19-12-13-20-16-17-22(26)21(20)14-9-8-10-15-23(27)24(28)30-3/h5,8-9,12-13,20-21,23,27,29H,2,4,6-7,10-11,14-19H2,1,3H3/t20-,21+,23?,25?/m0/s1 |
| InChIKey | MZOGVQZIUVXGQR-VRZXPUNVSA-N |
| XLogP | 4.68 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|