C23H35FO4 — CID 57203574
methyl 7-[(1R,2R)-2-[(4R)-4-(1-fluoroethenyl)oct-1-enyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoate (PubChem CID 57203574) has the molecular formula C23H35FO4 and a molecular weight of 394.53 g/mol. Its IUPAC name is methyl 7-[(1R,2R)-2-[(4R)-4-(1-fluoroethenyl)oct-1-enyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoate.
| Compound Name | methyl 7-[(1R,2R)-2-[(4R)-4-(1-fluoroethenyl)oct-1-enyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoate |
|---|---|
| PubChem CID | 57203574 |
| Molecular Formula | C23H35FO4 |
| Molecular Weight | 394.53 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | methyl 7-[(1R,2R)-2-[(4R)-4-(1-fluoroethenyl)oct-1-enyl]-5-oxocyclopentyl]-2-hydroxyhept-5-enoate |
| SMILES | C=C(F)[C@@H](CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCC(O)C(=O)OC)CCCC |
| InChI | InChI=1S/C23H35FO4/c1-4-5-10-18(17(2)24)11-9-12-19-15-16-21(25)20(19)13-7-6-8-14-22(26)23(27)28-3/h6-7,9,12,18-20,22,26H,2,4-5,8,10-11,13-16H2,1,3H3/t18-,19+,20-,22?/m1/s1 |
| InChIKey | CIOYJWARHOVGPA-DOFBDYGYSA-N |
| XLogP | 5.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|