C25H40O5 — CID 56610729
(2R)-2-acetyloxy-7-[(1R,2S,3R)-2-(4,4-dimethyloct-1-enyl)-3-methyl-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 56610729) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is (2R)-2-acetyloxy-7-[(1R,2S,3R)-2-(4,4-dimethyloct-1-enyl)-3-methyl-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (2R)-2-acetyloxy-7-[(1R,2S,3R)-2-(4,4-dimethyloct-1-enyl)-3-methyl-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 56610729 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | (2R)-2-acetyloxy-7-[(1R,2S,3R)-2-(4,4-dimethyloct-1-enyl)-3-methyl-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(C)(C)CC=C[C@@H]1[C@H](C)CC(=O)[C@@H]1CC=CCC[C@@H](OC(C)=O)C(=O)O |
| InChI | InChI=1S/C25H40O5/c1-6-7-15-25(4,5)16-11-13-20-18(2)17-22(27)21(20)12-9-8-10-14-23(24(28)29)30-19(3)26/h8-9,11,13,18,20-21,23H,6-7,10,12,14-17H2,1-5H3,(H,28,29)/t18-,20-,21-,23-/m1/s1 |
| InChIKey | CUFQNBFBMFOLMF-KTDPBYDISA-N |
| XLogP | 5.73 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|