C23H38O2 — CID 67951877
trans-(2R,4R)-3-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-2-[(Z)-hept-2-enyl]-4-methylcyclopentan-1-one (PubChem CID 67951877) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is trans-(2R,4R)-3-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-2-[(Z)-hept-2-enyl]-4-methylcyclopentan-1-one.
| Compound Name | trans-(2R,4R)-3-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-2-[(Z)-hept-2-enyl]-4-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 67951877 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | trans-(2R,4R)-3-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-2-[(Z)-hept-2-enyl]-4-methylcyclopentan-1-one |
| SMILES | CCCC/C=C\C[C@H]1C(=O)C[C@@H](C)C1/C=C/CC(O)C1(CC)CCC1 |
| InChI | InChI=1S/C23H38O2/c1-4-6-7-8-9-12-20-19(18(3)17-21(20)24)13-10-14-22(25)23(5-2)15-11-16-23/h8-10,13,18-20,22,25H,4-7,11-12,14-17H2,1-3H3/b9-8-,13-10+/t18-,19?,20-,22?/m1/s1 |
| InChIKey | ZLHWEGCIYKBUOT-JGLCGKKRSA-N |
| XLogP | 5.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|