C22H35O4P — CID 20782935
[(E)-6-[2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-5-oxocyclopent-3-en-1-yl]hex-4-enyl]-methylphosphinic acid (PubChem CID 20782935) has the molecular formula C22H35O4P and a molecular weight of 394.49 g/mol. Its IUPAC name is [(E)-6-[2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-5-oxocyclopent-3-en-1-yl]hex-4-enyl]-methylphosphinic acid.
| Compound Name | [(E)-6-[2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-5-oxocyclopent-3-en-1-yl]hex-4-enyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 20782935 |
| Molecular Formula | C22H35O4P |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | [(E)-6-[2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-5-oxocyclopent-3-en-1-yl]hex-4-enyl]-methylphosphinic acid |
| SMILES | CCC1(C(O)C/C=C/C2C=CC(=O)C2C/C=C/CCCP(C)(=O)O)CCC1 |
| InChI | InChI=1S/C22H35O4P/c1-3-22(15-9-16-22)21(24)12-8-10-18-13-14-20(23)19(18)11-6-4-5-7-17-27(2,25)26/h4,6,8,10,13-14,18-19,21,24H,3,5,7,9,11-12,15-17H2,1-2H3,(H,25,26)/b6-4+,10-8+ |
| InChIKey | HHENMUGBIKOTTH-ONNLMXTPSA-N |
| XLogP | 4.87 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|