C24H40O2 — CID 59070713
(2R,3R,4R)-2-[(Z)-hept-2-enyl]-3-[(E)-4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-4-methylcyclopentan-1-one (PubChem CID 59070713) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is (2R,3R,4R)-2-[(Z)-hept-2-enyl]-3-[(E)-4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-4-methylcyclopentan-1-one.
| Compound Name | (2R,3R,4R)-2-[(Z)-hept-2-enyl]-3-[(E)-4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-4-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 59070713 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | (2R,3R,4R)-2-[(Z)-hept-2-enyl]-3-[(E)-4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-4-methylcyclopentan-1-one |
| SMILES | CCCC/C=C\C[C@H]1C(=O)C[C@@H](C)[C@@H]1/C=C/CC(O)C1(CCC)CCC1 |
| InChI | InChI=1S/C24H40O2/c1-4-6-7-8-9-12-21-20(19(3)18-22(21)25)13-10-14-23(26)24(15-5-2)16-11-17-24/h8-10,13,19-21,23,26H,4-7,11-12,14-18H2,1-3H3/b9-8-,13-10+/t19-,20+,21-,23?/m1/s1 |
| InChIKey | GNDQIOCNAJVABS-OQLWTARNSA-N |
| XLogP | 6.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|