C22H37O5P — CID 90773812
6-[(1R,2R,3R)-2-[4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]hex-4-enyl-methylphosphinic acid (PubChem CID 90773812) has the molecular formula C22H37O5P and a molecular weight of 412.51 g/mol. Its IUPAC name is 6-[(1R,2R,3R)-2-[4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]hex-4-enyl-methylphosphinic acid.
| Compound Name | 6-[(1R,2R,3R)-2-[4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]hex-4-enyl-methylphosphinic acid |
|---|---|
| PubChem CID | 90773812 |
| Molecular Formula | C22H37O5P |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 6-[(1R,2R,3R)-2-[4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]hex-4-enyl-methylphosphinic acid |
| SMILES | CCC1(C(O)CC=C[C@H]2[C@H](O)CC(=O)[C@@H]2CC=CCCCP(C)(=O)O)CCC1 |
| InChI | InChI=1S/C22H37O5P/c1-3-22(13-9-14-22)21(25)12-8-11-18-17(19(23)16-20(18)24)10-6-4-5-7-15-28(2,26)27/h4,6,8,11,17-18,20-21,24-25H,3,5,7,9-10,12-16H2,1-2H3,(H,26,27)/t17-,18-,20-,21?/m1/s1 |
| InChIKey | PAQQEWHKLSRMOQ-HUTCVZBOSA-N |
| XLogP | 4.07 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|