C22H36O4 — CID 88530323
(Z)-7-[(1R,3R,5S)-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enal (PubChem CID 88530323) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is (Z)-7-[(1R,3R,5S)-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enal.
| Compound Name | (Z)-7-[(1R,3R,5S)-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enal |
|---|---|
| PubChem CID | 88530323 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (Z)-7-[(1R,3R,5S)-2-[(E)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3,5-dihydroxycyclopentyl]hept-5-enal |
| SMILES | CCC1(C(O)C/C=C/C2[C@H](O)C[C@H](O)[C@@H]2C/C=C\CCCC=O)CCC1 |
| InChI | InChI=1S/C22H36O4/c1-2-22(13-9-14-22)21(26)12-8-11-18-17(19(24)16-20(18)25)10-6-4-3-5-7-15-23/h4,6,8,11,15,17-21,24-26H,2-3,5,7,9-10,12-14,16H2,1H3/b6-4-,11-8+/t17-,18?,19+,20-,21?/m1/s1 |
| InChIKey | LHAIGNOQXPEESI-VTXIFXLKSA-N |
| XLogP | 3.55 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|