C23H39FO2 — CID 59070739
(1R,2R,3R,4R)-4-fluoro-3-[(Z)-hept-2-enyl]-2-[(E)-4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]cyclopentan-1-ol (PubChem CID 59070739) has the molecular formula C23H39FO2 and a molecular weight of 366.56 g/mol. Its IUPAC name is (1R,2R,3R,4R)-4-fluoro-3-[(Z)-hept-2-enyl]-2-[(E)-4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]cyclopentan-1-ol.
| Compound Name | (1R,2R,3R,4R)-4-fluoro-3-[(Z)-hept-2-enyl]-2-[(E)-4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 59070739 |
| Molecular Formula | C23H39FO2 |
| Molecular Weight | 366.56 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | (1R,2R,3R,4R)-4-fluoro-3-[(Z)-hept-2-enyl]-2-[(E)-4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]cyclopentan-1-ol |
| SMILES | CCCC/C=C\C[C@@H]1[C@@H](/C=C/CC(O)C2(CCC)CCC2)[C@H](O)C[C@H]1F |
| InChI | InChI=1S/C23H39FO2/c1-3-5-6-7-8-11-18-19(21(25)17-20(18)24)12-9-13-22(26)23(14-4-2)15-10-16-23/h7-9,12,18-22,25-26H,3-6,10-11,13-17H2,1-2H3/b8-7-,12-9+/t18-,19-,20-,21-,22?/m1/s1 |
| InChIKey | ZTAYGMWQDZIGPS-ZJBCQJEASA-N |
| XLogP | 5.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.56 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|