C24H32O5 — CID 91270743
4-[2-[(1R,2R)-2-[4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]ethyl]benzoic acid (PubChem CID 91270743) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-[2-[(1R,2R)-2-[4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(1R,2R)-2-[4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 91270743 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 4-[2-[(1R,2R)-2-[4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-3-hydroxy-5-oxocyclopentyl]ethyl]benzoic acid |
| SMILES | CCC1(C(O)CC=C[C@H]2C(O)CC(=O)[C@@H]2CCc2ccc(C(=O)O)cc2)CCC1 |
| InChI | InChI=1S/C24H32O5/c1-2-24(13-4-14-24)22(27)6-3-5-18-19(21(26)15-20(18)25)12-9-16-7-10-17(11-8-16)23(28)29/h3,5,7-8,10-11,18-20,22,25,27H,2,4,6,9,12-15H2,1H3,(H,28,29)/t18-,19-,20?,22?/m1/s1 |
| InChIKey | DSAFJVWSXZTKKA-NDUMYTTKSA-N |
| XLogP | 3.77 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|