C24H32O5S — CID 90865592
4-[[(2S)-3-hydroxy-2-[4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]sulfanylmethyl]benzoic acid (PubChem CID 90865592) has the molecular formula C24H32O5S and a molecular weight of 432.58 g/mol. Its IUPAC name is 4-[[(2S)-3-hydroxy-2-[4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]sulfanylmethyl]benzoic acid.
| Compound Name | 4-[[(2S)-3-hydroxy-2-[4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]sulfanylmethyl]benzoic acid |
|---|---|
| PubChem CID | 90865592 |
| Molecular Formula | C24H32O5S |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 4-[[(2S)-3-hydroxy-2-[4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]sulfanylmethyl]benzoic acid |
| SMILES | CCCC1(C(O)CC=C[C@H]2C(O)CC(=O)C2SCc2ccc(C(=O)O)cc2)CCC1 |
| InChI | InChI=1S/C24H32O5S/c1-2-11-24(12-4-13-24)21(27)6-3-5-18-19(25)14-20(26)22(18)30-15-16-7-9-17(10-8-16)23(28)29/h3,5,7-10,18-19,21-22,25,27H,2,4,6,11-15H2,1H3,(H,28,29)/t18-,19?,21?,22?/m0/s1 |
| InChIKey | YGLGABGIGGVTMA-RZMUKEPRSA-N |
| XLogP | 4.21 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|