C23H31NO4 — CID 59788311
4-[2-[2-[(E,4S)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid (PubChem CID 59788311) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is 4-[2-[2-[(E,4S)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[2-[(E,4S)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 59788311 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 4-[2-[2-[(E,4S)-4-(1-ethylcyclobutyl)-4-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid |
| SMILES | CCC1([C@@H](O)C/C=C/C2CCC(=O)N2CCc2ccc(C(=O)O)cc2)CCC1 |
| InChI | InChI=1S/C23H31NO4/c1-2-23(14-4-15-23)20(25)6-3-5-19-11-12-21(26)24(19)16-13-17-7-9-18(10-8-17)22(27)28/h3,5,7-10,19-20,25H,2,4,6,11-16H2,1H3,(H,27,28)/b5-3+/t19?,20-/m0/s1 |
| InChIKey | SXMOBVAAYULAFP-UWOFWYMESA-N |
| XLogP | 3.81 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|