C25H33NO4 — CID 90987104
4-[2-[2-[(4S)-4-[1-(cyclopropylmethyl)cyclobutyl]-4-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid (PubChem CID 90987104) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is 4-[2-[2-[(4S)-4-[1-(cyclopropylmethyl)cyclobutyl]-4-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[2-[(4S)-4-[1-(cyclopropylmethyl)cyclobutyl]-4-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 90987104 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 4-[2-[2-[(4S)-4-[1-(cyclopropylmethyl)cyclobutyl]-4-hydroxybut-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCN2C(=O)CCC2C=CC[C@H](O)C2(CC3CC3)CCC2)cc1 |
| InChI | InChI=1S/C25H33NO4/c27-22(25(14-2-15-25)17-19-5-6-19)4-1-3-21-11-12-23(28)26(21)16-13-18-7-9-20(10-8-18)24(29)30/h1,3,7-10,19,21-22,27H,2,4-6,11-17H2,(H,29,30)/t21?,22-/m0/s1 |
| InChIKey | MZBBBKULWLUKGD-KEKNWZKVSA-N |
| XLogP | 4.20 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|