C26H28ClNO4 — CID 69248825
4-[2-[(2R)-2-[(E,3S)-3-[1-(4-chlorophenyl)cyclobutyl]-3-hydroxyprop-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid (PubChem CID 69248825) has the molecular formula C26H28ClNO4 and a molecular weight of 453.97 g/mol. Its IUPAC name is 4-[2-[(2R)-2-[(E,3S)-3-[1-(4-chlorophenyl)cyclobutyl]-3-hydroxyprop-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(2R)-2-[(E,3S)-3-[1-(4-chlorophenyl)cyclobutyl]-3-hydroxyprop-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 69248825 |
| Molecular Formula | C26H28ClNO4 |
| Molecular Weight | 453.97 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 4-[2-[(2R)-2-[(E,3S)-3-[1-(4-chlorophenyl)cyclobutyl]-3-hydroxyprop-1-enyl]-5-oxopyrrolidin-1-yl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCN2C(=O)CC[C@@H]2/C=C/[C@H](O)C2(c3ccc(Cl)cc3)CCC2)cc1 |
| InChI | InChI=1S/C26H28ClNO4/c27-21-8-6-20(7-9-21)26(15-1-16-26)23(29)12-10-22-11-13-24(30)28(22)17-14-18-2-4-19(5-3-18)25(31)32/h2-10,12,22-23,29H,1,11,13-17H2,(H,31,32)/b12-10+/t22-,23-/m0/s1 |
| InChIKey | XBDHODCTYOZZNA-XPHCTPJTSA-N |
| XLogP | 4.61 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.97 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|