C24H32O5 — CID 59962765
4-[2-[(1R,2R)-2-[(E)-4-hydroxy-4-(1-methylcyclobutyl)but-1-enyl]-3-methoxy-5-oxocyclopentyl]ethyl]benzoic acid (PubChem CID 59962765) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-[2-[(1R,2R)-2-[(E)-4-hydroxy-4-(1-methylcyclobutyl)but-1-enyl]-3-methoxy-5-oxocyclopentyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[(1R,2R)-2-[(E)-4-hydroxy-4-(1-methylcyclobutyl)but-1-enyl]-3-methoxy-5-oxocyclopentyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 59962765 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 4-[2-[(1R,2R)-2-[(E)-4-hydroxy-4-(1-methylcyclobutyl)but-1-enyl]-3-methoxy-5-oxocyclopentyl]ethyl]benzoic acid |
| SMILES | COC1CC(=O)[C@H](CCc2ccc(C(=O)O)cc2)[C@H]1/C=C/CC(O)C1(C)CCC1 |
| InChI | InChI=1S/C24H32O5/c1-24(13-4-14-24)22(26)6-3-5-19-18(20(25)15-21(19)29-2)12-9-16-7-10-17(11-8-16)23(27)28/h3,5,7-8,10-11,18-19,21-22,26H,4,6,9,12-15H2,1-2H3,(H,27,28)/b5-3+/t18-,19-,21?,22?/m1/s1 |
| InChIKey | VKSOYWMQGOOIDJ-GEGZGGFKSA-N |
| XLogP | 4.03 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|