C21H30O5 — CID 54574905
7-[(1R,2R,3R)-3-hydroxy-2-[(E)-4-hydroxy-4-(1-methylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]hept-5-ynoic acid (PubChem CID 54574905) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 7-[(1R,2R,3R)-3-hydroxy-2-[(E)-4-hydroxy-4-(1-methylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]hept-5-ynoic acid.
| Compound Name | 7-[(1R,2R,3R)-3-hydroxy-2-[(E)-4-hydroxy-4-(1-methylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]hept-5-ynoic acid |
|---|---|
| PubChem CID | 54574905 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 7-[(1R,2R,3R)-3-hydroxy-2-[(E)-4-hydroxy-4-(1-methylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]hept-5-ynoic acid |
| SMILES | CC1(C(O)C/C=C/[C@H]2[C@H](O)CC(=O)[C@@H]2CC#CCCCC(=O)O)CCC1 |
| InChI | InChI=1S/C21H30O5/c1-21(12-7-13-21)19(24)10-6-9-16-15(17(22)14-18(16)23)8-4-2-3-5-11-20(25)26/h6,9,15-16,18-19,23-24H,3,5,7-8,10-14H2,1H3,(H,25,26)/b9-6+/t15-,16-,18-,19?/m1/s1 |
| InChIKey | ZZWVEBKWAXCXTC-CJZGDXIESA-N |
| XLogP | 2.70 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|