C24H34O4 — CID 163605844
(Z)-7-[(1R,2R,3R)-2-[(E)-4-(1-but-2-ynylcyclobutyl)but-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid (PubChem CID 163605844) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R)-2-[(E)-4-(1-but-2-ynylcyclobutyl)but-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R)-2-[(E)-4-(1-but-2-ynylcyclobutyl)but-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 163605844 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (Z)-7-[(1R,2R,3R)-2-[(E)-4-(1-but-2-ynylcyclobutyl)but-1-enyl]-3-hydroxy-5-oxocyclopentyl]hept-5-enoic acid |
| SMILES | CC#CCC1(CC/C=C/[C@H]2[C@H](O)CC(=O)[C@@H]2C/C=C\CCCC(=O)O)CCC1 |
| InChI | InChI=1S/C24H34O4/c1-2-3-14-24(16-10-17-24)15-9-8-12-20-19(21(25)18-22(20)26)11-6-4-5-7-13-23(27)28/h4,6,8,12,19-20,22,26H,5,7,9-11,13-18H2,1H3,(H,27,28)/b6-4-,12-8+/t19-,20-,22-/m1/s1 |
| InChIKey | HBRVRJWRRRSWSW-ONWFJLSWSA-N |
| XLogP | 4.67 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|