C24H30O5 — CID 11661261
7-[3-hydroxy-2-[(E)-3-hydroxy-5-phenylpent-1-enyl]-6-oxocyclohexyl]hept-5-ynoic acid (PubChem CID 11661261) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is 7-[3-hydroxy-2-[(E)-3-hydroxy-5-phenylpent-1-enyl]-6-oxocyclohexyl]hept-5-ynoic acid.
| Compound Name | 7-[3-hydroxy-2-[(E)-3-hydroxy-5-phenylpent-1-enyl]-6-oxocyclohexyl]hept-5-ynoic acid |
|---|---|
| PubChem CID | 11661261 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 7-[3-hydroxy-2-[(E)-3-hydroxy-5-phenylpent-1-enyl]-6-oxocyclohexyl]hept-5-ynoic acid |
| SMILES | O=C(O)CCCC#CCC1C(=O)CCC(O)C1/C=C/C(O)CCc1ccccc1 |
| InChI | InChI=1S/C24H30O5/c25-19(13-12-18-8-4-3-5-9-18)14-15-21-20(22(26)16-17-23(21)27)10-6-1-2-7-11-24(28)29/h3-5,8-9,14-15,19-21,23,25,27H,2,7,10-13,16-17H2,(H,28,29)/b15-14+ |
| InChIKey | QXXRUVOXEGCUQX-CCEZHUSRSA-N |
| XLogP | 3.14 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|