C22H32O6S — CID 70624525
7-[4-hydroxy-3-[(E)-3-hydroxy-5-phenylpent-1-enyl]-1,1-dioxothiolan-2-yl]heptanoic acid (PubChem CID 70624525) has the molecular formula C22H32O6S and a molecular weight of 424.56 g/mol. Its IUPAC name is 7-[4-hydroxy-3-[(E)-3-hydroxy-5-phenylpent-1-enyl]-1,1-dioxothiolan-2-yl]heptanoic acid.
| Compound Name | 7-[4-hydroxy-3-[(E)-3-hydroxy-5-phenylpent-1-enyl]-1,1-dioxothiolan-2-yl]heptanoic acid |
|---|---|
| PubChem CID | 70624525 |
| Molecular Formula | C22H32O6S |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 7-[4-hydroxy-3-[(E)-3-hydroxy-5-phenylpent-1-enyl]-1,1-dioxothiolan-2-yl]heptanoic acid |
| SMILES | O=C(O)CCCCCCC1C(/C=C/C(O)CCc2ccccc2)C(O)CS1(=O)=O |
| InChI | InChI=1S/C22H32O6S/c23-18(13-12-17-8-4-3-5-9-17)14-15-19-20(24)16-29(27,28)21(19)10-6-1-2-7-11-22(25)26/h3-5,8-9,14-15,18-21,23-24H,1-2,6-7,10-13,16H2,(H,25,26)/b15-14+ |
| InChIKey | BFGSEKWSPLHGOC-CCEZHUSRSA-N |
| XLogP | 2.74 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|