C30H46O4 — CID 18395383
7-[(4R,5R)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(4-phenylbutyl)cyclopenten-1-yl]heptanoic acid (PubChem CID 18395383) has the molecular formula C30H46O4 and a molecular weight of 470.69 g/mol. Its IUPAC name is 7-[(4R,5R)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(4-phenylbutyl)cyclopenten-1-yl]heptanoic acid.
| Compound Name | 7-[(4R,5R)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(4-phenylbutyl)cyclopenten-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 18395383 |
| Molecular Formula | C30H46O4 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.34 |
| IUPAC Name | 7-[(4R,5R)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(4-phenylbutyl)cyclopenten-1-yl]heptanoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1C(CCCCCCC(=O)O)=C(CCCCc2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C30H46O4/c1-2-3-7-18-26(31)21-22-28-27(19-10-4-5-11-20-30(33)34)25(23-29(28)32)17-13-12-16-24-14-8-6-9-15-24/h6,8-9,14-15,21-22,26,28-29,31-32H,2-5,7,10-13,16-20,23H2,1H3,(H,33,34)/b22-21+/t26-,28+,29+/m0/s1 |
| InChIKey | JZEIZLCGLCTXBM-ZRPHXERHSA-N |
| XLogP | 7.00 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|