C24H40O5 — CID 57017903
7-[(5R)-2-acetyl-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]heptanoic acid (PubChem CID 57017903) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is 7-[(5R)-2-acetyl-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]heptanoic acid.
| Compound Name | 7-[(5R)-2-acetyl-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 57017903 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | 7-[(5R)-2-acetyl-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]heptanoic acid |
| SMILES | CCCC[C@@H](C)C[C@H](O)C=C[C@@H]1C(CCCCCCC(=O)O)=C(C(C)=O)CC1O |
| InChI | InChI=1S/C24H40O5/c1-4-5-10-17(2)15-19(26)13-14-21-20(22(18(3)25)16-23(21)27)11-8-6-7-9-12-24(28)29/h13-14,17,19,21,23,26-27H,4-12,15-16H2,1-3H3,(H,28,29)/t17-,19-,21-,23?/m1/s1 |
| InChIKey | FNCRTTIMNDAPQE-HUTUGTLRSA-N |
| XLogP | 4.81 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|