C21H35FO4 — CID 18395396
7-[(4R,5R)-2-(fluoromethyl)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]heptanoic acid (PubChem CID 18395396) has the molecular formula C21H35FO4 and a molecular weight of 370.51 g/mol. Its IUPAC name is 7-[(4R,5R)-2-(fluoromethyl)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]heptanoic acid.
| Compound Name | 7-[(4R,5R)-2-(fluoromethyl)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 18395396 |
| Molecular Formula | C21H35FO4 |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 7-[(4R,5R)-2-(fluoromethyl)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]heptanoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1C(CCCCCCC(=O)O)=C(CF)C[C@H]1O |
| InChI | InChI=1S/C21H35FO4/c1-2-3-6-9-17(23)12-13-19-18(16(15-22)14-20(19)24)10-7-4-5-8-11-21(25)26/h12-13,17,19-20,23-24H,2-11,14-15H2,1H3,(H,25,26)/b13-12+/t17-,19+,20+/m0/s1 |
| InChIKey | RYTXEMWWZUKZDN-XRDBVSSGSA-N |
| XLogP | 4.56 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|