C23H38O4 — CID 57163336
7-[(4R,5R)-2-cyclopropyl-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]heptanoic acid (PubChem CID 57163336) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is 7-[(4R,5R)-2-cyclopropyl-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]heptanoic acid.
| Compound Name | 7-[(4R,5R)-2-cyclopropyl-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 57163336 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | 7-[(4R,5R)-2-cyclopropyl-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]heptanoic acid |
| SMILES | CCCCC[C@H](O)C=C[C@@H]1C(CCCCCCC(=O)O)=C(C2CC2)C[C@H]1O |
| InChI | InChI=1S/C23H38O4/c1-2-3-6-9-18(24)14-15-20-19(10-7-4-5-8-11-23(26)27)21(16-22(20)25)17-12-13-17/h14-15,17-18,20,22,24-25H,2-13,16H2,1H3,(H,26,27)/t18-,20+,22+/m0/s1 |
| InChIKey | XIQMPHQYYRLAID-CZTZKLFOSA-N |
| XLogP | 5.00 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|