C25H44O4 — CID 57275456
7-[(4R,5R)-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]-2-pentylcyclopenten-1-yl]heptanoic acid (PubChem CID 57275456) has the molecular formula C25H44O4 and a molecular weight of 408.62 g/mol. Its IUPAC name is 7-[(4R,5R)-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]-2-pentylcyclopenten-1-yl]heptanoic acid.
| Compound Name | 7-[(4R,5R)-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]-2-pentylcyclopenten-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 57275456 |
| Molecular Formula | C25H44O4 |
| Molecular Weight | 408.62 g/mol |
| Exact Mass | 408.32 |
| IUPAC Name | 7-[(4R,5R)-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]-2-pentylcyclopenten-1-yl]heptanoic acid |
| SMILES | CCCCCC1=C(CCCCCCC(=O)O)[C@@H](C=C[C@@H](O)CCCCC)[C@H](O)C1 |
| InChI | InChI=1S/C25H44O4/c1-3-5-9-13-20-19-24(27)23(18-17-21(26)14-10-6-4-2)22(20)15-11-7-8-12-16-25(28)29/h17-18,21,23-24,26-27H,3-16,19H2,1-2H3,(H,28,29)/t21-,23+,24+/m0/s1 |
| InChIKey | JSFJMZHGFQKMJH-QPTUXGOLSA-N |
| XLogP | 6.17 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|