C24H42O4 — CID 57173168
7-[(4R,5R)-2-butan-2-yl-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]heptanoic acid (PubChem CID 57173168) has the molecular formula C24H42O4 and a molecular weight of 394.60 g/mol. Its IUPAC name is 7-[(4R,5R)-2-butan-2-yl-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]heptanoic acid.
| Compound Name | 7-[(4R,5R)-2-butan-2-yl-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 57173168 |
| Molecular Formula | C24H42O4 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | 7-[(4R,5R)-2-butan-2-yl-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]heptanoic acid |
| SMILES | CCCCC[C@H](O)C=C[C@@H]1C(CCCCCCC(=O)O)=C(C(C)CC)C[C@H]1O |
| InChI | InChI=1S/C24H42O4/c1-4-6-9-12-19(25)15-16-21-20(13-10-7-8-11-14-24(27)28)22(17-23(21)26)18(3)5-2/h15-16,18-19,21,23,25-26H,4-14,17H2,1-3H3,(H,27,28)/t18?,19-,21+,23+/m0/s1 |
| InChIKey | CMABLIABMJQNCT-CJDLJOMHSA-N |
| XLogP | 5.63 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|