C28H40O6S — CID 22883752
6-[(4R,5S)-2-butanoyloxy-4-hydroxy-5-[(3S)-3-hydroxy-7-phenylhept-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid (PubChem CID 22883752) has the molecular formula C28H40O6S and a molecular weight of 504.69 g/mol. Its IUPAC name is 6-[(4R,5S)-2-butanoyloxy-4-hydroxy-5-[(3S)-3-hydroxy-7-phenylhept-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid.
| Compound Name | 6-[(4R,5S)-2-butanoyloxy-4-hydroxy-5-[(3S)-3-hydroxy-7-phenylhept-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 22883752 |
| Molecular Formula | C28H40O6S |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 6-[(4R,5S)-2-butanoyloxy-4-hydroxy-5-[(3S)-3-hydroxy-7-phenylhept-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid |
| SMILES | CCCC(=O)OC1=C(SCCCCCC(=O)O)[C@@H](C=C[C@@H](O)CCCCc2ccccc2)[C@H](O)C1 |
| InChI | InChI=1S/C28H40O6S/c1-2-11-27(33)34-25-20-24(30)23(28(25)35-19-10-4-7-16-26(31)32)18-17-22(29)15-9-8-14-21-12-5-3-6-13-21/h3,5-6,12-13,17-18,22-24,29-30H,2,4,7-11,14-16,19-20H2,1H3,(H,31,32)/t22-,23-,24+/m0/s1 |
| InChIKey | QMSHBCDZVIHHDK-KMDXXIMOSA-N |
| XLogP | 5.63 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|