C27H46O6S — CID 22883801
methyl 6-[(4R,5S)-2-(2,2-dimethylpropanoyloxy)-4-hydroxy-5-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate (PubChem CID 22883801) has the molecular formula C27H46O6S and a molecular weight of 498.73 g/mol. Its IUPAC name is methyl 6-[(4R,5S)-2-(2,2-dimethylpropanoyloxy)-4-hydroxy-5-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate.
| Compound Name | methyl 6-[(4R,5S)-2-(2,2-dimethylpropanoyloxy)-4-hydroxy-5-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 22883801 |
| Molecular Formula | C27H46O6S |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | methyl 6-[(4R,5S)-2-(2,2-dimethylpropanoyloxy)-4-hydroxy-5-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate |
| SMILES | CCCC[C@@H](C)C[C@H](O)/C=C/[C@@H]1C(SCCCCCC(=O)OC)=C(OC(=O)C(C)(C)C)C[C@H]1O |
| InChI | InChI=1S/C27H46O6S/c1-7-8-12-19(2)17-20(28)14-15-21-22(29)18-23(33-26(31)27(3,4)5)25(21)34-16-11-9-10-13-24(30)32-6/h14-15,19-22,28-29H,7-13,16-18H2,1-6H3/b15-14+/t19-,20-,21+,22-/m1/s1 |
| InChIKey | MRXMGIQTIUMSTR-NWPRSDMGSA-N |
| XLogP | 5.77 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|