C27H38O6S — CID 22883762
6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(4-methylbenzoyl)oxycyclopenten-1-yl]sulfanylhexanoic acid (PubChem CID 22883762) has the molecular formula C27H38O6S and a molecular weight of 490.66 g/mol. Its IUPAC name is 6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(4-methylbenzoyl)oxycyclopenten-1-yl]sulfanylhexanoic acid.
| Compound Name | 6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(4-methylbenzoyl)oxycyclopenten-1-yl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 22883762 |
| Molecular Formula | C27H38O6S |
| Molecular Weight | 490.66 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-(4-methylbenzoyl)oxycyclopenten-1-yl]sulfanylhexanoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1C(SCCCCCC(=O)O)=C(OC(=O)c2ccc(C)cc2)C[C@H]1O |
| InChI | InChI=1S/C27H38O6S/c1-3-4-6-9-21(28)15-16-22-23(29)18-24(26(22)34-17-8-5-7-10-25(30)31)33-27(32)20-13-11-19(2)12-14-20/h11-16,21-23,28-29H,3-10,17-18H2,1-2H3,(H,30,31)/b16-15+/t21-,22-,23+/m0/s1 |
| InChIKey | FRJDLXSJCYCCDK-JEEUUIAFSA-N |
| XLogP | 5.62 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.66 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|