C24H40O6S — CID 22883748
6-[(4R,5S)-2-butanoyloxy-4-hydroxy-5-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid (PubChem CID 22883748) has the molecular formula C24H40O6S and a molecular weight of 456.65 g/mol. Its IUPAC name is 6-[(4R,5S)-2-butanoyloxy-4-hydroxy-5-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid.
| Compound Name | 6-[(4R,5S)-2-butanoyloxy-4-hydroxy-5-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 22883748 |
| Molecular Formula | C24H40O6S |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 6-[(4R,5S)-2-butanoyloxy-4-hydroxy-5-[(E,3S)-3-hydroxy-3-methyloct-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid |
| SMILES | CCCCC[C@](C)(O)/C=C/[C@@H]1C(SCCCCCC(=O)O)=C(OC(=O)CCC)C[C@H]1O |
| InChI | InChI=1S/C24H40O6S/c1-4-6-9-14-24(3,29)15-13-18-19(25)17-20(30-22(28)11-5-2)23(18)31-16-10-7-8-12-21(26)27/h13,15,18-19,25,29H,4-12,14,16-17H2,1-3H3,(H,26,27)/b15-13+/t18-,19+,24-/m0/s1 |
| InChIKey | FKLWAPNTMARAGB-RLQWFOHYSA-N |
| XLogP | 5.19 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|