C23H40O4S — CID 57076164
methyl 6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]sulfanylhexanoate (PubChem CID 57076164) has the molecular formula C23H40O4S and a molecular weight of 412.64 g/mol. Its IUPAC name is methyl 6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]sulfanylhexanoate.
| Compound Name | methyl 6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 57076164 |
| Molecular Formula | C23H40O4S |
| Molecular Weight | 412.64 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | methyl 6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]-2-methylcyclopenten-1-yl]sulfanylhexanoate |
| SMILES | CCCC[C@@H](C)C[C@H](O)C=C[C@@H]1C(SCCCCCC(=O)OC)=C(C)C[C@H]1O |
| InChI | InChI=1S/C23H40O4S/c1-5-6-10-17(2)15-19(24)12-13-20-21(25)16-18(3)23(20)28-14-9-7-8-11-22(26)27-4/h12-13,17,19-21,24-25H,5-11,14-16H2,1-4H3/t17-,19-,20+,21-/m1/s1 |
| InChIKey | FBEKBZJKXJDWLG-AYWYSENESA-N |
| XLogP | 5.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.64 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|