C23H36O6S — CID 56981433
6-[(4R,5S)-2-but-2-enoyloxy-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid (PubChem CID 56981433) has the molecular formula C23H36O6S and a molecular weight of 440.60 g/mol. Its IUPAC name is 6-[(4R,5S)-2-but-2-enoyloxy-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid.
| Compound Name | 6-[(4R,5S)-2-but-2-enoyloxy-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 56981433 |
| Molecular Formula | C23H36O6S |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 6-[(4R,5S)-2-but-2-enoyloxy-4-hydroxy-5-[(3S)-3-hydroxyoct-1-enyl]cyclopenten-1-yl]sulfanylhexanoic acid |
| SMILES | CC=CC(=O)OC1=C(SCCCCCC(=O)O)[C@@H](C=C[C@@H](O)CCCCC)[C@H](O)C1 |
| InChI | InChI=1S/C23H36O6S/c1-3-5-7-11-17(24)13-14-18-19(25)16-20(29-22(28)10-4-2)23(18)30-15-9-6-8-12-21(26)27/h4,10,13-14,17-19,24-25H,3,5-9,11-12,15-16H2,1-2H3,(H,26,27)/t17-,18-,19+/m0/s1 |
| InChIKey | VDOWYYMKSAREEV-GBESFXJTSA-N |
| XLogP | 4.57 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|