C22H36O6S — CID 22883761
6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-propanoyloxycyclopenten-1-yl]sulfanylhexanoic acid (PubChem CID 22883761) has the molecular formula C22H36O6S and a molecular weight of 428.59 g/mol. Its IUPAC name is 6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-propanoyloxycyclopenten-1-yl]sulfanylhexanoic acid.
| Compound Name | 6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-propanoyloxycyclopenten-1-yl]sulfanylhexanoic acid |
|---|---|
| PubChem CID | 22883761 |
| Molecular Formula | C22H36O6S |
| Molecular Weight | 428.59 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 6-[(4R,5S)-4-hydroxy-5-[(E,3S)-3-hydroxyoct-1-enyl]-2-propanoyloxycyclopenten-1-yl]sulfanylhexanoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1C(SCCCCCC(=O)O)=C(OC(=O)CC)C[C@H]1O |
| InChI | InChI=1S/C22H36O6S/c1-3-5-7-10-16(23)12-13-17-18(24)15-19(28-21(27)4-2)22(17)29-14-9-6-8-11-20(25)26/h12-13,16-18,23-24H,3-11,14-15H2,1-2H3,(H,25,26)/b13-12+/t16-,17-,18+/m0/s1 |
| InChIKey | ZGCKODLCHSDFHC-GPVXIOJZSA-N |
| XLogP | 4.41 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.59 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|