C24H40O6S — CID 22883790
methyl 6-[(4R,5S)-2-acetyloxy-4-hydroxy-5-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate (PubChem CID 22883790) has the molecular formula C24H40O6S and a molecular weight of 456.65 g/mol. Its IUPAC name is methyl 6-[(4R,5S)-2-acetyloxy-4-hydroxy-5-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate.
| Compound Name | methyl 6-[(4R,5S)-2-acetyloxy-4-hydroxy-5-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 22883790 |
| Molecular Formula | C24H40O6S |
| Molecular Weight | 456.65 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | methyl 6-[(4R,5S)-2-acetyloxy-4-hydroxy-5-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate |
| SMILES | CCCC[C@@H](C)C[C@H](O)/C=C/[C@@H]1C(SCCCCCC(=O)OC)=C(OC(C)=O)C[C@H]1O |
| InChI | InChI=1S/C24H40O6S/c1-5-6-10-17(2)15-19(26)12-13-20-21(27)16-22(30-18(3)25)24(20)31-14-9-7-8-11-23(28)29-4/h12-13,17,19-21,26-27H,5-11,14-16H2,1-4H3/b13-12+/t17-,19-,20+,21-/m1/s1 |
| InChIKey | CHJVAUUYBQMIAD-LOXYIIBSSA-N |
| XLogP | 4.74 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|