C26H42O6S — CID 22883829
methyl (E)-6-[(4R,5S)-2-butanoyloxy-4-hydroxy-5-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhex-2-enoate (PubChem CID 22883829) has the molecular formula C26H42O6S and a molecular weight of 482.68 g/mol. Its IUPAC name is methyl (E)-6-[(4R,5S)-2-butanoyloxy-4-hydroxy-5-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhex-2-enoate.
| Compound Name | methyl (E)-6-[(4R,5S)-2-butanoyloxy-4-hydroxy-5-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhex-2-enoate |
|---|---|
| PubChem CID | 22883829 |
| Molecular Formula | C26H42O6S |
| Molecular Weight | 482.68 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | methyl (E)-6-[(4R,5S)-2-butanoyloxy-4-hydroxy-5-[(E,3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhex-2-enoate |
| SMILES | CCCC[C@@H](C)C[C@H](O)/C=C/[C@@H]1C(SCCC/C=C/C(=O)OC)=C(OC(=O)CCC)C[C@H]1O |
| InChI | InChI=1S/C26H42O6S/c1-5-7-12-19(3)17-20(27)14-15-21-22(28)18-23(32-25(30)11-6-2)26(21)33-16-10-8-9-13-24(29)31-4/h9,13-15,19-22,27-28H,5-8,10-12,16-18H2,1-4H3/b13-9+,15-14+/t19-,20-,21+,22-/m1/s1 |
| InChIKey | INRREZVBIGHDNJ-QAJHAZTMSA-N |
| XLogP | 5.30 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.68 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|