C22H38O4S — CID 57037234
methyl 6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate (PubChem CID 57037234) has the molecular formula C22H38O4S and a molecular weight of 398.61 g/mol. Its IUPAC name is methyl 6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate.
| Compound Name | methyl 6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 57037234 |
| Molecular Formula | C22H38O4S |
| Molecular Weight | 398.61 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | methyl 6-[(4R,5S)-4-hydroxy-5-[(3S,5R)-3-hydroxy-5-methylnon-1-enyl]cyclopenten-1-yl]sulfanylhexanoate |
| SMILES | CCCC[C@@H](C)C[C@H](O)C=C[C@@H]1C(SCCCCCC(=O)OC)=CC[C@H]1O |
| InChI | InChI=1S/C22H38O4S/c1-4-5-9-17(2)16-18(23)11-12-19-20(24)13-14-21(19)27-15-8-6-7-10-22(25)26-3/h11-12,14,17-20,23-24H,4-10,13,15-16H2,1-3H3/t17-,18-,19+,20-/m1/s1 |
| InChIKey | QAZIEBNFJZWFTH-YSTOQKLRSA-N |
| XLogP | 4.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|