C23H38O7S — CID 22883808
methyl 6-[(4R,5S)-2-butanoyloxy-5-[(E,3S)-5-ethoxy-3-hydroxypent-1-enyl]-4-hydroxycyclopenten-1-yl]sulfanylhexanoate (PubChem CID 22883808) has the molecular formula C23H38O7S and a molecular weight of 458.62 g/mol. Its IUPAC name is methyl 6-[(4R,5S)-2-butanoyloxy-5-[(E,3S)-5-ethoxy-3-hydroxypent-1-enyl]-4-hydroxycyclopenten-1-yl]sulfanylhexanoate.
| Compound Name | methyl 6-[(4R,5S)-2-butanoyloxy-5-[(E,3S)-5-ethoxy-3-hydroxypent-1-enyl]-4-hydroxycyclopenten-1-yl]sulfanylhexanoate |
|---|---|
| PubChem CID | 22883808 |
| Molecular Formula | C23H38O7S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | methyl 6-[(4R,5S)-2-butanoyloxy-5-[(E,3S)-5-ethoxy-3-hydroxypent-1-enyl]-4-hydroxycyclopenten-1-yl]sulfanylhexanoate |
| SMILES | CCCC(=O)OC1=C(SCCCCCC(=O)OC)[C@@H](/C=C/[C@@H](O)CCOCC)[C@H](O)C1 |
| InChI | InChI=1S/C23H38O7S/c1-4-9-22(27)30-20-16-19(25)18(12-11-17(24)13-14-29-5-2)23(20)31-15-8-6-7-10-21(26)28-3/h11-12,17-19,24-25H,4-10,13-16H2,1-3H3/b12-11+/t17-,18+,19-/m1/s1 |
| InChIKey | RIRXPZNLQKTYQP-OOYHNUBKSA-N |
| XLogP | 3.73 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|