C22H36O5S2 — CID 69338434
methyl 2-[3-[(2S,3R)-3-hydroxy-2-[4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate (PubChem CID 69338434) has the molecular formula C22H36O5S2 and a molecular weight of 444.66 g/mol. Its IUPAC name is methyl 2-[3-[(2S,3R)-3-hydroxy-2-[4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate.
| Compound Name | methyl 2-[3-[(2S,3R)-3-hydroxy-2-[4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
|---|---|
| PubChem CID | 69338434 |
| Molecular Formula | C22H36O5S2 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | methyl 2-[3-[(2S,3R)-3-hydroxy-2-[4-hydroxy-4-(1-propylcyclobutyl)but-1-enyl]-5-oxocyclopentyl]sulfanylpropylsulfanyl]acetate |
| SMILES | CCCC1(C(O)CC=C[C@@H]2C(SCCCSCC(=O)OC)C(=O)C[C@H]2O)CCC1 |
| InChI | InChI=1S/C22H36O5S2/c1-3-9-22(10-5-11-22)19(25)8-4-7-16-17(23)14-18(24)21(16)29-13-6-12-28-15-20(26)27-2/h4,7,16-17,19,21,23,25H,3,5-6,8-15H2,1-2H3/t16-,17+,19?,21?/m0/s1 |
| InChIKey | JTYQLKRXGPRSDC-JPPFFPKXSA-N |
| XLogP | 3.61 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|