C23H36O4 — CID 70596510
(4S,5R)-4-[(E)-4-hydroxydec-1-enyl]-5-[(Z)-8-hydroxy-7-oxooct-2-enyl]cyclopent-2-en-1-one (PubChem CID 70596510) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is (4S,5R)-4-[(E)-4-hydroxydec-1-enyl]-5-[(Z)-8-hydroxy-7-oxooct-2-enyl]cyclopent-2-en-1-one.
| Compound Name | (4S,5R)-4-[(E)-4-hydroxydec-1-enyl]-5-[(Z)-8-hydroxy-7-oxooct-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 70596510 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | (4S,5R)-4-[(E)-4-hydroxydec-1-enyl]-5-[(Z)-8-hydroxy-7-oxooct-2-enyl]cyclopent-2-en-1-one |
| SMILES | CCCCCCC(O)C/C=C/[C@H]1C=CC(=O)[C@@H]1C/C=C\CCCC(=O)CO |
| InChI | InChI=1S/C23H36O4/c1-2-3-4-7-12-20(25)14-10-11-19-16-17-23(27)22(19)15-9-6-5-8-13-21(26)18-24/h6,9-11,16-17,19-20,22,24-25H,2-5,7-8,12-15,18H2,1H3/b9-6-,11-10+/t19-,20?,22+/m0/s1 |
| InChIKey | YNBFACAFXJZTMK-GWHPJZQPSA-N |
| XLogP | 4.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|