C24H36O4 — CID 70596792
(4S,5R)-4-[(1E)-4-hydroxy-4-methyldeca-1,5-dienyl]-5-[(Z)-8-hydroxy-7-oxooct-2-enyl]cyclopent-2-en-1-one (PubChem CID 70596792) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (4S,5R)-4-[(1E)-4-hydroxy-4-methyldeca-1,5-dienyl]-5-[(Z)-8-hydroxy-7-oxooct-2-enyl]cyclopent-2-en-1-one.
| Compound Name | (4S,5R)-4-[(1E)-4-hydroxy-4-methyldeca-1,5-dienyl]-5-[(Z)-8-hydroxy-7-oxooct-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 70596792 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (4S,5R)-4-[(1E)-4-hydroxy-4-methyldeca-1,5-dienyl]-5-[(Z)-8-hydroxy-7-oxooct-2-enyl]cyclopent-2-en-1-one |
| SMILES | CCCCC=CC(C)(O)C/C=C/[C@H]1C=CC(=O)[C@@H]1C/C=C\CCCC(=O)CO |
| InChI | InChI=1S/C24H36O4/c1-3-4-5-10-17-24(2,28)18-11-12-20-15-16-23(27)22(20)14-9-7-6-8-13-21(26)19-25/h7,9-12,15-17,20,22,25,28H,3-6,8,13-14,18-19H2,1-2H3/b9-7-,12-11+,17-10?/t20-,22+,24?/m0/s1 |
| InChIKey | YLDUVUNTVHAGEJ-XMVWZXFNSA-N |
| XLogP | 4.48 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|