C26H38O5 — CID 70594913
[(Z)-8-[(1R,2S)-2-[(1E)-4-hydroxy-4-methyldeca-1,5-dienyl]-5-oxocyclopent-3-en-1-yl]-2-oxooct-6-enyl] acetate (PubChem CID 70594913) has the molecular formula C26H38O5 and a molecular weight of 430.59 g/mol. Its IUPAC name is [(Z)-8-[(1R,2S)-2-[(1E)-4-hydroxy-4-methyldeca-1,5-dienyl]-5-oxocyclopent-3-en-1-yl]-2-oxooct-6-enyl] acetate.
| Compound Name | [(Z)-8-[(1R,2S)-2-[(1E)-4-hydroxy-4-methyldeca-1,5-dienyl]-5-oxocyclopent-3-en-1-yl]-2-oxooct-6-enyl] acetate |
|---|---|
| PubChem CID | 70594913 |
| Molecular Formula | C26H38O5 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | [(Z)-8-[(1R,2S)-2-[(1E)-4-hydroxy-4-methyldeca-1,5-dienyl]-5-oxocyclopent-3-en-1-yl]-2-oxooct-6-enyl] acetate |
| SMILES | CCCCC=CC(C)(O)C/C=C/[C@H]1C=CC(=O)[C@@H]1C/C=C\CCCC(=O)COC(C)=O |
| InChI | InChI=1S/C26H38O5/c1-4-5-6-11-18-26(3,30)19-12-13-22-16-17-25(29)24(22)15-10-8-7-9-14-23(28)20-31-21(2)27/h8,10-13,16-18,22,24,30H,4-7,9,14-15,19-20H2,1-3H3/b10-8-,13-12+,18-11?/t22-,24+,26?/m0/s1 |
| InChIKey | VULZWJPKLTUOMW-QSCRIZFISA-N |
| XLogP | 5.05 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|